C16H16N4O5S — CID 108732800
N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-2-(2-methoxyethoxy)acetamide (PubChem CID 108732800) has the molecular formula C16H16N4O5S and a molecular weight of 376.39 g/mol. Its IUPAC name is N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-2-(2-methoxyethoxy)acetamide.
| Compound Name | N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-2-(2-methoxyethoxy)acetamide |
|---|---|
| PubChem CID | 108732800 |
| Molecular Formula | C16H16N4O5S |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-2-(2-methoxyethoxy)acetamide |
| SMILES | COCCOCC(=O)Nc1nnc(CN2C(=O)c3ccccc3C2=O)s1 |
| InChI | InChI=1S/C16H16N4O5S/c1-24-6-7-25-9-12(21)17-16-19-18-13(26-16)8-20-14(22)10-4-2-3-5-11(10)15(20)23/h2-5H,6-9H2,1H3,(H,17,19,21) |
| InChIKey | HHZUQTKMDNUXSU-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|