C21H17ClN4O4S — CID 108756186
2-(4-chlorophenoxy)-N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-2-methylpropanamide (PubChem CID 108756186) has the molecular formula C21H17ClN4O4S and a molecular weight of 456.91 g/mol. Its IUPAC name is 2-(4-chlorophenoxy)-N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-2-methylpropanamide.
| Compound Name | 2-(4-chlorophenoxy)-N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 108756186 |
| Molecular Formula | C21H17ClN4O4S |
| Molecular Weight | 456.91 g/mol |
| Exact Mass | 456.07 |
| IUPAC Name | 2-(4-chlorophenoxy)-N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-2-methylpropanamide |
| SMILES | CC(C)(Oc1ccc(Cl)cc1)C(=O)Nc1nnc(CN2C(=O)c3ccccc3C2=O)s1 |
| InChI | InChI=1S/C21H17ClN4O4S/c1-21(2,30-13-9-7-12(22)8-10-13)19(29)23-20-25-24-16(31-20)11-26-17(27)14-5-3-4-6-15(14)18(26)28/h3-10H,11H2,1-2H3,(H,23,25,29) |
| InChIKey | UWDAGTNZAUXMQC-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.91 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|