C18H14N4O5S2 — CID 108781480
N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-4-methoxybenzenesulfonamide (PubChem CID 108781480) has the molecular formula C18H14N4O5S2 and a molecular weight of 430.47 g/mol. Its IUPAC name is N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-4-methoxybenzenesulfonamide.
| Compound Name | N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 108781480 |
| Molecular Formula | C18H14N4O5S2 |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.04 |
| IUPAC Name | N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)Nc2nnc(CN3C(=O)c4ccccc4C3=O)s2)cc1 |
| InChI | InChI=1S/C18H14N4O5S2/c1-27-11-6-8-12(9-7-11)29(25,26)21-18-20-19-15(28-18)10-22-16(23)13-4-2-3-5-14(13)17(22)24/h2-9H,10H2,1H3,(H,20,21) |
| InChIKey | SMYMTEBFTZFLSE-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|