C16H11ClN6O2S — CID 108773847
2-[[5-[(2-chloro-6-methylpyrimidin-4-yl)amino]-1,3,4-thiadiazol-2-yl]methyl]isoindole-1,3-dione (PubChem CID 108773847) has the molecular formula C16H11ClN6O2S and a molecular weight of 386.82 g/mol. Its IUPAC name is 2-[[5-[(2-chloro-6-methylpyrimidin-4-yl)amino]-1,3,4-thiadiazol-2-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[5-[(2-chloro-6-methylpyrimidin-4-yl)amino]-1,3,4-thiadiazol-2-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 108773847 |
| Molecular Formula | C16H11ClN6O2S |
| Molecular Weight | 386.82 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | 2-[[5-[(2-chloro-6-methylpyrimidin-4-yl)amino]-1,3,4-thiadiazol-2-yl]methyl]isoindole-1,3-dione |
| SMILES | Cc1cc(Nc2nnc(CN3C(=O)c4ccccc4C3=O)s2)nc(Cl)n1 |
| InChI | InChI=1S/C16H11ClN6O2S/c1-8-6-11(19-15(17)18-8)20-16-22-21-12(26-16)7-23-13(24)9-4-2-3-5-10(9)14(23)25/h2-6H,7H2,1H3,(H,18,19,20,22) |
| InChIKey | KQHYMQAXRBETTL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 100.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.82 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|