C16H10N8O2S — CID 108773848
2-[[5-(7H-purin-6-ylamino)-1,3,4-thiadiazol-2-yl]methyl]isoindole-1,3-dione (PubChem CID 108773848) has the molecular formula C16H10N8O2S and a molecular weight of 378.38 g/mol. Its IUPAC name is 2-[[5-(7H-purin-6-ylamino)-1,3,4-thiadiazol-2-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[5-(7H-purin-6-ylamino)-1,3,4-thiadiazol-2-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 108773848 |
| Molecular Formula | C16H10N8O2S |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.06 |
| IUPAC Name | 2-[[5-(7H-purin-6-ylamino)-1,3,4-thiadiazol-2-yl]methyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1Cc1nnc(Nc2ncnc3nc[nH]c23)s1 |
| InChI | InChI=1S/C16H10N8O2S/c25-14-8-3-1-2-4-9(8)15(26)24(14)5-10-22-23-16(27-10)21-13-11-12(18-6-17-11)19-7-20-13/h1-4,6-7H,5H2,(H2,17,18,19,20,21,23) |
| InChIKey | CMVUQBKUCWQERZ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 129.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|