C19H11N5O4S — CID 108811668
N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-1,3-benzoxazole-5-carboxamide (PubChem CID 108811668) has the molecular formula C19H11N5O4S and a molecular weight of 405.40 g/mol. Its IUPAC name is N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-1,3-benzoxazole-5-carboxamide.
| Compound Name | N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-1,3-benzoxazole-5-carboxamide |
|---|---|
| PubChem CID | 108811668 |
| Molecular Formula | C19H11N5O4S |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.05 |
| IUPAC Name | N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-1,3-benzoxazole-5-carboxamide |
| SMILES | O=C(Nc1nnc(CN2C(=O)c3ccccc3C2=O)s1)c1ccc2ocnc2c1 |
| InChI | InChI=1S/C19H11N5O4S/c25-16(10-5-6-14-13(7-10)20-9-28-14)21-19-23-22-15(29-19)8-24-17(26)11-3-1-2-4-12(11)18(24)27/h1-7,9H,8H2,(H,21,23,25) |
| InChIKey | IQRKEJMGPSKUCH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 118.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|