C22H16N6O3S — CID 108756301
N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-2,3-dimethylquinoxaline-6-carboxamide (PubChem CID 108756301) has the molecular formula C22H16N6O3S and a molecular weight of 444.48 g/mol. Its IUPAC name is N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-2,3-dimethylquinoxaline-6-carboxamide.
| Compound Name | N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-2,3-dimethylquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 108756301 |
| Molecular Formula | C22H16N6O3S |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-2,3-dimethylquinoxaline-6-carboxamide |
| SMILES | Cc1nc2ccc(C(=O)Nc3nnc(CN4C(=O)c5ccccc5C4=O)s3)cc2nc1C |
| InChI | InChI=1S/C22H16N6O3S/c1-11-12(2)24-17-9-13(7-8-16(17)23-11)19(29)25-22-27-26-18(32-22)10-28-20(30)14-5-3-4-6-15(14)21(28)31/h3-9H,10H2,1-2H3,(H,25,27,29) |
| InChIKey | DROHKVOOZKOEMC-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 118.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|