C25H17N7O3S — CID 108810853
N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-5-methyl-1-quinolin-2-ylpyrazole-4-carboxamide (PubChem CID 108810853) has the molecular formula C25H17N7O3S and a molecular weight of 495.52 g/mol. Its IUPAC name is N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-5-methyl-1-quinolin-2-ylpyrazole-4-carboxamide.
| Compound Name | N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-5-methyl-1-quinolin-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 108810853 |
| Molecular Formula | C25H17N7O3S |
| Molecular Weight | 495.52 g/mol |
| Exact Mass | 495.11 |
| IUPAC Name | N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-5-methyl-1-quinolin-2-ylpyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)Nc2nnc(CN3C(=O)c4ccccc4C3=O)s2)cnn1-c1ccc2ccccc2n1 |
| InChI | InChI=1S/C25H17N7O3S/c1-14-18(12-26-32(14)20-11-10-15-6-2-5-9-19(15)27-20)22(33)28-25-30-29-21(36-25)13-31-23(34)16-7-3-4-8-17(16)24(31)35/h2-12H,13H2,1H3,(H,28,30,33) |
| InChIKey | RXSCRXNBIQXDTG-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 122.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|