C26H18N6O3S — CID 108801953
N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3-thiazol-2-yl]-5-methyl-1-quinolin-2-ylpyrazole-4-carboxamide (PubChem CID 108801953) has the molecular formula C26H18N6O3S and a molecular weight of 494.54 g/mol. Its IUPAC name is N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3-thiazol-2-yl]-5-methyl-1-quinolin-2-ylpyrazole-4-carboxamide.
| Compound Name | N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3-thiazol-2-yl]-5-methyl-1-quinolin-2-ylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 108801953 |
| Molecular Formula | C26H18N6O3S |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3-thiazol-2-yl]-5-methyl-1-quinolin-2-ylpyrazole-4-carboxamide |
| SMILES | Cc1c(C(=O)Nc2ncc(CN3C(=O)c4ccccc4C3=O)s2)cnn1-c1ccc2ccccc2n1 |
| InChI | InChI=1S/C26H18N6O3S/c1-15-20(13-28-32(15)22-11-10-16-6-2-5-9-21(16)29-22)23(33)30-26-27-12-17(36-26)14-31-24(34)18-7-3-4-8-19(18)25(31)35/h2-13H,14H2,1H3,(H,27,30,33) |
| InChIKey | XWPNHTOAEQVSFM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|