C13H9ClN4O3S — CID 3764789
2-chloro-N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 3764789) has the molecular formula C13H9ClN4O3S and a molecular weight of 336.76 g/mol. Its IUPAC name is 2-chloro-N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-chloro-N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 3764789 |
| Molecular Formula | C13H9ClN4O3S |
| Molecular Weight | 336.76 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | 2-chloro-N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | O=C(CCl)Nc1nnc(CN2C(=O)c3ccccc3C2=O)s1 |
| InChI | InChI=1S/C13H9ClN4O3S/c14-5-9(19)15-13-17-16-10(22-13)6-18-11(20)7-3-1-2-4-8(7)12(18)21/h1-4H,5-6H2,(H,15,17,19) |
| InChIKey | VZFPKVBGZRPUIQ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.76 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|