C20H12Cl2N4O3S — CID 108756255
(E)-3-(3,4-dichlorophenyl)-N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide (PubChem CID 108756255) has the molecular formula C20H12Cl2N4O3S and a molecular weight of 459.31 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 108756255 |
| Molecular Formula | C20H12Cl2N4O3S |
| Molecular Weight | 459.31 g/mol |
| Exact Mass | 458.00 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)Nc1nnc(CN2C(=O)c3ccccc3C2=O)s1 |
| InChI | InChI=1S/C20H12Cl2N4O3S/c21-14-7-5-11(9-15(14)22)6-8-16(27)23-20-25-24-17(30-20)10-26-18(28)12-3-1-2-4-13(12)19(26)29/h1-9H,10H2,(H,23,25,27)/b8-6+ |
| InChIKey | UAKWICGLRIHUIU-SOFGYWHQSA-N |
| XLogP | 4.29 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.31 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|