C15H9Cl2N3OS2 — CID 108766372
(E)-3-(3,4-dichlorophenyl)-N-(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide (PubChem CID 108766372) has the molecular formula C15H9Cl2N3OS2 and a molecular weight of 382.30 g/mol. Its IUPAC name is (E)-3-(3,4-dichlorophenyl)-N-(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide.
| Compound Name | (E)-3-(3,4-dichlorophenyl)-N-(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 108766372 |
| Molecular Formula | C15H9Cl2N3OS2 |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 380.96 |
| IUPAC Name | (E)-3-(3,4-dichlorophenyl)-N-(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)c(Cl)c1)Nc1nnc(-c2cccs2)s1 |
| InChI | InChI=1S/C15H9Cl2N3OS2/c16-10-5-3-9(8-11(10)17)4-6-13(21)18-15-20-19-14(23-15)12-2-1-7-22-12/h1-8H,(H,18,20,21)/b6-4+ |
| InChIKey | ZOXMFJOQTOAAQP-GQCTYLIASA-N |
| XLogP | 5.23 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|