C17H13N3O3S2 — CID 108744000
methyl 4-[(E)-3-oxo-3-[(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)amino]prop-1-enyl]benzoate (PubChem CID 108744000) has the molecular formula C17H13N3O3S2 and a molecular weight of 371.44 g/mol. Its IUPAC name is methyl 4-[(E)-3-oxo-3-[(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)amino]prop-1-enyl]benzoate.
| Compound Name | methyl 4-[(E)-3-oxo-3-[(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)amino]prop-1-enyl]benzoate |
|---|---|
| PubChem CID | 108744000 |
| Molecular Formula | C17H13N3O3S2 |
| Molecular Weight | 371.44 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | methyl 4-[(E)-3-oxo-3-[(5-thiophen-2-yl-1,3,4-thiadiazol-2-yl)amino]prop-1-enyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C/C(=O)Nc2nnc(-c3cccs3)s2)cc1 |
| InChI | InChI=1S/C17H13N3O3S2/c1-23-16(22)12-7-4-11(5-8-12)6-9-14(21)18-17-20-19-15(25-17)13-3-2-10-24-13/h2-10H,1H3,(H,18,20,21)/b9-6+ |
| InChIKey | ONYIVBFJJRFOOE-RMKNXTFCSA-N |
| XLogP | 3.71 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|