C25H20N4O2S2 — CID 11213619
(E)-3-(4-methoxyphenyl)-N-[5-(phenothiazin-10-ylmethyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide (PubChem CID 11213619) has the molecular formula C25H20N4O2S2 and a molecular weight of 472.60 g/mol. Its IUPAC name is (E)-3-(4-methoxyphenyl)-N-[5-(phenothiazin-10-ylmethyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(4-methoxyphenyl)-N-[5-(phenothiazin-10-ylmethyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 11213619 |
| Molecular Formula | C25H20N4O2S2 |
| Molecular Weight | 472.60 g/mol |
| Exact Mass | 472.10 |
| IUPAC Name | (E)-3-(4-methoxyphenyl)-N-[5-(phenothiazin-10-ylmethyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2nnc(CN3c4ccccc4Sc4ccccc43)s2)cc1 |
| InChI | InChI=1S/C25H20N4O2S2/c1-31-18-13-10-17(11-14-18)12-15-23(30)26-25-28-27-24(33-25)16-29-19-6-2-4-8-21(19)32-22-9-5-3-7-20(22)29/h2-15H,16H2,1H3,(H,26,28,30)/b15-12+ |
| InChIKey | OGBVHIYUYGBUOV-NTCAYCPXSA-N |
| XLogP | 6.00 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.60 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|