C24H24N4O3S — CID 17203782
(E)-N-[5-[1-(2-ethylphenyl)-5-oxopyrrolidin-3-yl]-1,3,4-thiadiazol-2-yl]-3-(4-methoxyphenyl)prop-2-enamide (PubChem CID 17203782) has the molecular formula C24H24N4O3S and a molecular weight of 448.55 g/mol. Its IUPAC name is (E)-N-[5-[1-(2-ethylphenyl)-5-oxopyrrolidin-3-yl]-1,3,4-thiadiazol-2-yl]-3-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[5-[1-(2-ethylphenyl)-5-oxopyrrolidin-3-yl]-1,3,4-thiadiazol-2-yl]-3-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17203782 |
| Molecular Formula | C24H24N4O3S |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.16 |
| IUPAC Name | (E)-N-[5-[1-(2-ethylphenyl)-5-oxopyrrolidin-3-yl]-1,3,4-thiadiazol-2-yl]-3-(4-methoxyphenyl)prop-2-enamide |
| SMILES | CCc1ccccc1N1CC(c2nnc(NC(=O)/C=C/c3ccc(OC)cc3)s2)CC1=O |
| InChI | InChI=1S/C24H24N4O3S/c1-3-17-6-4-5-7-20(17)28-15-18(14-22(28)30)23-26-27-24(32-23)25-21(29)13-10-16-8-11-19(31-2)12-9-16/h4-13,18H,3,14-15H2,1-2H3,(H,25,27,29)/b13-10+ |
| InChIKey | XHIKHNNNQNLZBP-JLHYYAGUSA-N |
| XLogP | 4.28 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|