C23H22N4O4S — CID 40966035
[4-[[5-[(3R)-1-(2-ethylphenyl)-5-oxopyrrolidin-3-yl]-1,3,4-thiadiazol-2-yl]carbamoyl]phenyl] acetate (PubChem CID 40966035) has the molecular formula C23H22N4O4S and a molecular weight of 450.52 g/mol. Its IUPAC name is [4-[[5-[(3R)-1-(2-ethylphenyl)-5-oxopyrrolidin-3-yl]-1,3,4-thiadiazol-2-yl]carbamoyl]phenyl] acetate.
| Compound Name | [4-[[5-[(3R)-1-(2-ethylphenyl)-5-oxopyrrolidin-3-yl]-1,3,4-thiadiazol-2-yl]carbamoyl]phenyl] acetate |
|---|---|
| PubChem CID | 40966035 |
| Molecular Formula | C23H22N4O4S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | [4-[[5-[(3R)-1-(2-ethylphenyl)-5-oxopyrrolidin-3-yl]-1,3,4-thiadiazol-2-yl]carbamoyl]phenyl] acetate |
| SMILES | CCc1ccccc1N1C[C@H](c2nnc(NC(=O)c3ccc(OC(C)=O)cc3)s2)CC1=O |
| InChI | InChI=1S/C23H22N4O4S/c1-3-15-6-4-5-7-19(15)27-13-17(12-20(27)29)22-25-26-23(32-22)24-21(30)16-8-10-18(11-9-16)31-14(2)28/h4-11,17H,3,12-13H2,1-2H3,(H,24,26,30)/t17-/m1/s1 |
| InChIKey | HEQSWDLHQXLECU-QGZVFWFLSA-N |
| XLogP | 3.80 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|