C19H12N6O7S — CID 108732796
N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-4-methyl-3,5-dinitrobenzamide (PubChem CID 108732796) has the molecular formula C19H12N6O7S and a molecular weight of 468.41 g/mol. Its IUPAC name is N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-4-methyl-3,5-dinitrobenzamide.
| Compound Name | N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-4-methyl-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 108732796 |
| Molecular Formula | C19H12N6O7S |
| Molecular Weight | 468.41 g/mol |
| Exact Mass | 468.05 |
| IUPAC Name | N-[5-[(1,3-dioxoisoindol-2-yl)methyl]-1,3,4-thiadiazol-2-yl]-4-methyl-3,5-dinitrobenzamide |
| SMILES | Cc1c([N+](=O)[O-])cc(C(=O)Nc2nnc(CN3C(=O)c4ccccc4C3=O)s2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H12N6O7S/c1-9-13(24(29)30)6-10(7-14(9)25(31)32)16(26)20-19-22-21-15(33-19)8-23-17(27)11-4-2-3-5-12(11)18(23)28/h2-7H,8H2,1H3,(H,20,22,26) |
| InChIKey | HNYPOZIWNSVHSB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 178.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|