C17H13ClN6O2S — CID 108777875
2-[2-[5-[(6-chloro-2-methylpyrimidin-4-yl)amino]-1,3,4-thiadiazol-2-yl]ethyl]isoindole-1,3-dione (PubChem CID 108777875) has the molecular formula C17H13ClN6O2S and a molecular weight of 400.85 g/mol. Its IUPAC name is 2-[2-[5-[(6-chloro-2-methylpyrimidin-4-yl)amino]-1,3,4-thiadiazol-2-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[5-[(6-chloro-2-methylpyrimidin-4-yl)amino]-1,3,4-thiadiazol-2-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 108777875 |
| Molecular Formula | C17H13ClN6O2S |
| Molecular Weight | 400.85 g/mol |
| Exact Mass | 400.05 |
| IUPAC Name | 2-[2-[5-[(6-chloro-2-methylpyrimidin-4-yl)amino]-1,3,4-thiadiazol-2-yl]ethyl]isoindole-1,3-dione |
| SMILES | Cc1nc(Cl)cc(Nc2nnc(CCN3C(=O)c4ccccc4C3=O)s2)n1 |
| InChI | InChI=1S/C17H13ClN6O2S/c1-9-19-12(18)8-13(20-9)21-17-23-22-14(27-17)6-7-24-15(25)10-4-2-3-5-11(10)16(24)26/h2-5,8H,6-7H2,1H3,(H,19,20,21,23) |
| InChIKey | GHEILAQIDMMWQU-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 100.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.85 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|