C14H12N2O2S — CID 1497777
2-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]isoindole-1,3-dione (PubChem CID 1497777) has the molecular formula C14H12N2O2S and a molecular weight of 272.33 g/mol. Its IUPAC name is 2-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 1497777 |
| Molecular Formula | C14H12N2O2S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.06 |
| IUPAC Name | 2-[2-(4-methyl-1,3-thiazol-2-yl)ethyl]isoindole-1,3-dione |
| SMILES | Cc1csc(CCN2C(=O)c3ccccc3C2=O)n1 |
| InChI | InChI=1S/C14H12N2O2S/c1-9-8-19-12(15-9)6-7-16-13(17)10-4-2-3-5-11(10)14(16)18/h2-5,8H,6-7H2,1H3 |
| InChIKey | WAKHWVGZCVQKGA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|