C15H16N4O2 — CID 10802980
2-[2-(1-ethyl-5-methyl-1,2,4-triazol-3-yl)ethyl]isoindole-1,3-dione (PubChem CID 10802980) has the molecular formula C15H16N4O2 and a molecular weight of 284.32 g/mol. Its IUPAC name is 2-[2-(1-ethyl-5-methyl-1,2,4-triazol-3-yl)ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(1-ethyl-5-methyl-1,2,4-triazol-3-yl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 10802980 |
| Molecular Formula | C15H16N4O2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.13 |
| IUPAC Name | 2-[2-(1-ethyl-5-methyl-1,2,4-triazol-3-yl)ethyl]isoindole-1,3-dione |
| SMILES | CCn1nc(CCN2C(=O)c3ccccc3C2=O)nc1C |
| InChI | InChI=1S/C15H16N4O2/c1-3-19-10(2)16-13(17-19)8-9-18-14(20)11-6-4-5-7-12(11)15(18)21/h4-7H,3,8-9H2,1-2H3 |
| InChIKey | VPMLREWGQVZVLH-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|