C16H13NO2S — CID 53469378
2-[2-(4-sulfanylphenyl)ethyl]isoindole-1,3-dione (PubChem CID 53469378) has the molecular formula C16H13NO2S and a molecular weight of 283.35 g/mol. Its IUPAC name is 2-[2-(4-sulfanylphenyl)ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(4-sulfanylphenyl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 53469378 |
| Molecular Formula | C16H13NO2S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 2-[2-(4-sulfanylphenyl)ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCc1ccc(S)cc1 |
| InChI | InChI=1S/C16H13NO2S/c18-15-13-3-1-2-4-14(13)16(19)17(15)10-9-11-5-7-12(20)8-6-11/h1-8,20H,9-10H2 |
| InChIKey | DKXRQVMRJVYPEX-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|