C20H19NO5 — CID 11725612
4-[4-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenoxy]butanoic acid (PubChem CID 11725612) has the molecular formula C20H19NO5 and a molecular weight of 353.37 g/mol. Its IUPAC name is 4-[4-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenoxy]butanoic acid.
| Compound Name | 4-[4-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenoxy]butanoic acid |
|---|---|
| PubChem CID | 11725612 |
| Molecular Formula | C20H19NO5 |
| Molecular Weight | 353.37 g/mol |
| Exact Mass | 353.13 |
| IUPAC Name | 4-[4-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenoxy]butanoic acid |
| SMILES | O=C(O)CCCOc1ccc(CCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C20H19NO5/c22-18(23)6-3-13-26-15-9-7-14(8-10-15)11-12-21-19(24)16-4-1-2-5-17(16)20(21)25/h1-2,4-5,7-10H,3,6,11-13H2,(H,22,23) |
| InChIKey | CSZCXZOWWYGHQG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.37 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|