C28H27NO5 — CID 1179074
[4-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenyl] 2-(4-tert-butylphenoxy)acetate (PubChem CID 1179074) has the molecular formula C28H27NO5 and a molecular weight of 457.53 g/mol. Its IUPAC name is [4-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenyl] 2-(4-tert-butylphenoxy)acetate.
| Compound Name | [4-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenyl] 2-(4-tert-butylphenoxy)acetate |
|---|---|
| PubChem CID | 1179074 |
| Molecular Formula | C28H27NO5 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | [4-[2-(1,3-dioxoisoindol-2-yl)ethyl]phenyl] 2-(4-tert-butylphenoxy)acetate |
| SMILES | CC(C)(C)c1ccc(OCC(=O)Oc2ccc(CCN3C(=O)c4ccccc4C3=O)cc2)cc1 |
| InChI | InChI=1S/C28H27NO5/c1-28(2,3)20-10-14-21(15-11-20)33-18-25(30)34-22-12-8-19(9-13-22)16-17-29-26(31)23-6-4-5-7-24(23)27(29)32/h4-15H,16-18H2,1-3H3 |
| InChIKey | XGDPXPCONTUULI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|