C24H19NO4 — CID 1184334
[4-(4-methylphenyl)phenyl] 3-(1,3-dioxoisoindol-2-yl)propanoate (PubChem CID 1184334) has the molecular formula C24H19NO4 and a molecular weight of 385.42 g/mol. Its IUPAC name is [4-(4-methylphenyl)phenyl] 3-(1,3-dioxoisoindol-2-yl)propanoate.
| Compound Name | [4-(4-methylphenyl)phenyl] 3-(1,3-dioxoisoindol-2-yl)propanoate |
|---|---|
| PubChem CID | 1184334 |
| Molecular Formula | C24H19NO4 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.13 |
| IUPAC Name | [4-(4-methylphenyl)phenyl] 3-(1,3-dioxoisoindol-2-yl)propanoate |
| SMILES | Cc1ccc(-c2ccc(OC(=O)CCN3C(=O)c4ccccc4C3=O)cc2)cc1 |
| InChI | InChI=1S/C24H19NO4/c1-16-6-8-17(9-7-16)18-10-12-19(13-11-18)29-22(26)14-15-25-23(27)20-4-2-3-5-21(20)24(25)28/h2-13H,14-15H2,1H3 |
| InChIKey | URXYPNBRUWXAMQ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|