C26H22N2O5 — CID 19176414
[4-[(4-methylphenyl)carbamoyl]phenyl] 4-(1,3-dioxoisoindol-2-yl)butanoate (PubChem CID 19176414) has the molecular formula C26H22N2O5 and a molecular weight of 442.47 g/mol. Its IUPAC name is [4-[(4-methylphenyl)carbamoyl]phenyl] 4-(1,3-dioxoisoindol-2-yl)butanoate.
| Compound Name | [4-[(4-methylphenyl)carbamoyl]phenyl] 4-(1,3-dioxoisoindol-2-yl)butanoate |
|---|---|
| PubChem CID | 19176414 |
| Molecular Formula | C26H22N2O5 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.15 |
| IUPAC Name | [4-[(4-methylphenyl)carbamoyl]phenyl] 4-(1,3-dioxoisoindol-2-yl)butanoate |
| SMILES | Cc1ccc(NC(=O)c2ccc(OC(=O)CCCN3C(=O)c4ccccc4C3=O)cc2)cc1 |
| InChI | InChI=1S/C26H22N2O5/c1-17-8-12-19(13-9-17)27-24(30)18-10-14-20(15-11-18)33-23(29)7-4-16-28-25(31)21-5-2-3-6-22(21)26(28)32/h2-3,5-6,8-15H,4,7,16H2,1H3,(H,27,30) |
| InChIKey | PRLAVCQYPDYFBW-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|