C25H22N2O3S — CID 22779288
N-[4-[3-(1,3-dioxoisoindol-2-yl)propylsulfanyl]phenyl]-3-methylbenzamide (PubChem CID 22779288) has the molecular formula C25H22N2O3S and a molecular weight of 430.53 g/mol. Its IUPAC name is N-[4-[3-(1,3-dioxoisoindol-2-yl)propylsulfanyl]phenyl]-3-methylbenzamide.
| Compound Name | N-[4-[3-(1,3-dioxoisoindol-2-yl)propylsulfanyl]phenyl]-3-methylbenzamide |
|---|---|
| PubChem CID | 22779288 |
| Molecular Formula | C25H22N2O3S |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | N-[4-[3-(1,3-dioxoisoindol-2-yl)propylsulfanyl]phenyl]-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)Nc2ccc(SCCCN3C(=O)c4ccccc4C3=O)cc2)c1 |
| InChI | InChI=1S/C25H22N2O3S/c1-17-6-4-7-18(16-17)23(28)26-19-10-12-20(13-11-19)31-15-5-14-27-24(29)21-8-2-3-9-22(21)25(27)30/h2-4,6-13,16H,5,14-15H2,1H3,(H,26,28) |
| InChIKey | HGXUAAYFOFSKQM-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|