C23H17FN2O3S — CID 22777349
N-[4-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]phenyl]-4-fluorobenzamide (PubChem CID 22777349) has the molecular formula C23H17FN2O3S and a molecular weight of 420.47 g/mol. Its IUPAC name is N-[4-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]phenyl]-4-fluorobenzamide.
| Compound Name | N-[4-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]phenyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 22777349 |
| Molecular Formula | C23H17FN2O3S |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.09 |
| IUPAC Name | N-[4-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]phenyl]-4-fluorobenzamide |
| SMILES | O=C(Nc1ccc(SCCN2C(=O)c3ccccc3C2=O)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H17FN2O3S/c24-16-7-5-15(6-8-16)21(27)25-17-9-11-18(12-10-17)30-14-13-26-22(28)19-3-1-2-4-20(19)23(26)29/h1-12H,13-14H2,(H,25,27) |
| InChIKey | OVJPPGFGWGUHKW-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|