C24H20N2O4S — CID 22779662
N-[4-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]phenyl]-2-phenoxyacetamide (PubChem CID 22779662) has the molecular formula C24H20N2O4S and a molecular weight of 432.50 g/mol. Its IUPAC name is N-[4-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]phenyl]-2-phenoxyacetamide.
| Compound Name | N-[4-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]phenyl]-2-phenoxyacetamide |
|---|---|
| PubChem CID | 22779662 |
| Molecular Formula | C24H20N2O4S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.11 |
| IUPAC Name | N-[4-[2-(1,3-dioxoisoindol-2-yl)ethylsulfanyl]phenyl]-2-phenoxyacetamide |
| SMILES | O=C(COc1ccccc1)Nc1ccc(SCCN2C(=O)c3ccccc3C2=O)cc1 |
| InChI | InChI=1S/C24H20N2O4S/c27-22(16-30-18-6-2-1-3-7-18)25-17-10-12-19(13-11-17)31-15-14-26-23(28)20-8-4-5-9-21(20)24(26)29/h1-13H,14-16H2,(H,25,27) |
| InChIKey | MWGJYNNNFACONZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|