C19H20N4O3S — CID 9324948
2-[[4-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]piperazin-1-yl]methyl]isoindole-1,3-dione (PubChem CID 9324948) has the molecular formula C19H20N4O3S and a molecular weight of 384.46 g/mol. Its IUPAC name is 2-[[4-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]piperazin-1-yl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[4-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]piperazin-1-yl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 9324948 |
| Molecular Formula | C19H20N4O3S |
| Molecular Weight | 384.46 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 2-[[4-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]piperazin-1-yl]methyl]isoindole-1,3-dione |
| SMILES | Cc1csc(CC(=O)N2CCN(CN3C(=O)c4ccccc4C3=O)CC2)n1 |
| InChI | InChI=1S/C19H20N4O3S/c1-13-11-27-16(20-13)10-17(24)22-8-6-21(7-9-22)12-23-18(25)14-4-2-3-5-15(14)19(23)26/h2-5,11H,6-10,12H2,1H3 |
| InChIKey | DQJABRZLFNCQCO-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.46 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|