C19H25N4O3S+ — CID 9325024
(3aR,7aR)-2-[[4-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]piperazin-1-ium-1-yl]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 9325024) has the molecular formula C19H25N4O3S+ and a molecular weight of 389.50 g/mol. Its IUPAC name is (3aR,7aR)-2-[[4-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]piperazin-1-ium-1-yl]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aR,7aR)-2-[[4-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]piperazin-1-ium-1-yl]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 9325024 |
| Molecular Formula | C19H25N4O3S+ |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | (3aR,7aR)-2-[[4-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]piperazin-1-ium-1-yl]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | Cc1csc(CC(=O)N2CC[NH+](CN3C(=O)[C@@H]4CC=CC[C@H]4C3=O)CC2)n1 |
| InChI | InChI=1S/C19H24N4O3S/c1-13-11-27-16(20-13)10-17(24)22-8-6-21(7-9-22)12-23-18(25)14-4-2-3-5-15(14)19(23)26/h2-3,11,14-15H,4-10,12H2,1H3/p+1/t14-,15-/m1/s1 |
| InChIKey | NRILDWOQRGTMHL-HUUCEWRRSA-O |
| XLogP | -0.37 |
| TPSA | 75.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|