C18H21ClN4OS2 — CID 8560220
N-(3-chloro-4-methylphenyl)-4-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]piperazine-1-carbothioamide (PubChem CID 8560220) has the molecular formula C18H21ClN4OS2 and a molecular weight of 408.98 g/mol. Its IUPAC name is N-(3-chloro-4-methylphenyl)-4-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]piperazine-1-carbothioamide.
| Compound Name | N-(3-chloro-4-methylphenyl)-4-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8560220 |
| Molecular Formula | C18H21ClN4OS2 |
| Molecular Weight | 408.98 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | N-(3-chloro-4-methylphenyl)-4-[2-(4-methyl-1,3-thiazol-2-yl)acetyl]piperazine-1-carbothioamide |
| SMILES | Cc1csc(CC(=O)N2CCN(C(=S)Nc3ccc(C)c(Cl)c3)CC2)n1 |
| InChI | InChI=1S/C18H21ClN4OS2/c1-12-3-4-14(9-15(12)19)21-18(25)23-7-5-22(6-8-23)17(24)10-16-20-13(2)11-26-16/h3-4,9,11H,5-8,10H2,1-2H3,(H,21,25) |
| InChIKey | JCTBNZUGTFWGFV-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.98 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|