C22H28N3O6S+ — CID 2466862
ethyl 4-[4-[[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]methyl]piperazin-4-ium-1-yl]sulfonylbenzoate (PubChem CID 2466862) has the molecular formula C22H28N3O6S+ and a molecular weight of 462.55 g/mol. Its IUPAC name is ethyl 4-[4-[[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]methyl]piperazin-4-ium-1-yl]sulfonylbenzoate.
| Compound Name | ethyl 4-[4-[[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]methyl]piperazin-4-ium-1-yl]sulfonylbenzoate |
|---|---|
| PubChem CID | 2466862 |
| Molecular Formula | C22H28N3O6S+ |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | ethyl 4-[4-[[(3aS,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]methyl]piperazin-4-ium-1-yl]sulfonylbenzoate |
| SMILES | CCOC(=O)c1ccc(S(=O)(=O)N2CC[NH+](CN3C(=O)[C@H]4CC=CC[C@@H]4C3=O)CC2)cc1 |
| InChI | InChI=1S/C22H27N3O6S/c1-2-31-22(28)16-7-9-17(10-8-16)32(29,30)24-13-11-23(12-14-24)15-25-20(26)18-5-3-4-6-19(18)21(25)27/h3-4,7-10,18-19H,2,5-6,11-15H2,1H3/p+1/t18-,19-/m0/s1 |
| InChIKey | YNCOWJDTNAWQPA-OALUTQOASA-O |
| XLogP | -0.34 |
| TPSA | 105.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|