C19H23FN3O4S+ — CID 7911430
(3aR,7aR)-2-[[4-(3-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 7911430) has the molecular formula C19H23FN3O4S+ and a molecular weight of 408.48 g/mol. Its IUPAC name is (3aR,7aR)-2-[[4-(3-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aR,7aR)-2-[[4-(3-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 7911430 |
| Molecular Formula | C19H23FN3O4S+ |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | (3aR,7aR)-2-[[4-(3-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | O=C1[C@@H]2CC=CC[C@H]2C(=O)N1C[NH+]1CCN(S(=O)(=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C19H22FN3O4S/c20-14-4-3-5-15(12-14)28(26,27)22-10-8-21(9-11-22)13-23-18(24)16-6-1-2-7-17(16)19(23)25/h1-5,12,16-17H,6-11,13H2/p+1/t16-,17-/m1/s1 |
| InChIKey | ZSYPIIVQNHWCOU-IAGOWNOFSA-O |
| XLogP | -0.38 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|