C15H19FN3O4S+ — CID 2663722
1-[[4-(3-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]pyrrolidine-2,5-dione (PubChem CID 2663722) has the molecular formula C15H19FN3O4S+ and a molecular weight of 356.40 g/mol. Its IUPAC name is 1-[[4-(3-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]pyrrolidine-2,5-dione.
| Compound Name | 1-[[4-(3-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 2663722 |
| Molecular Formula | C15H19FN3O4S+ |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 1-[[4-(3-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]pyrrolidine-2,5-dione |
| SMILES | O=C1CCC(=O)N1C[NH+]1CCN(S(=O)(=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C15H18FN3O4S/c16-12-2-1-3-13(10-12)24(22,23)18-8-6-17(7-9-18)11-19-14(20)4-5-15(19)21/h1-3,10H,4-9,11H2/p+1 |
| InChIKey | KJBHGDBTIFNZBZ-UHFFFAOYSA-O |
| XLogP | -1.18 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|