C17H23FN5O2S2+ — CID 9244214
4-cyclopropyl-2-[[4-(3-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-5-methyl-1,2,4-triazole-3-thione (PubChem CID 9244214) has the molecular formula C17H23FN5O2S2+ and a molecular weight of 412.54 g/mol. Its IUPAC name is 4-cyclopropyl-2-[[4-(3-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-5-methyl-1,2,4-triazole-3-thione.
| Compound Name | 4-cyclopropyl-2-[[4-(3-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-5-methyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 9244214 |
| Molecular Formula | C17H23FN5O2S2+ |
| Molecular Weight | 412.54 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 4-cyclopropyl-2-[[4-(3-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]methyl]-5-methyl-1,2,4-triazole-3-thione |
| SMILES | Cc1nn(C[NH+]2CCN(S(=O)(=O)c3cccc(F)c3)CC2)c(=S)n1C1CC1 |
| InChI | InChI=1S/C17H22FN5O2S2/c1-13-19-22(17(26)23(13)15-5-6-15)12-20-7-9-21(10-8-20)27(24,25)16-4-2-3-14(18)11-16/h2-4,11,15H,5-10,12H2,1H3/p+1 |
| InChIKey | QKUXEEUMUWVBMX-UHFFFAOYSA-O |
| XLogP | 0.74 |
| TPSA | 64.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.54 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|