C17H24N5O2S2+ — CID 9235343
2-[[4-(benzenesulfonyl)piperazin-1-ium-1-yl]methyl]-5-methyl-4-prop-2-enyl-1,2,4-triazole-3-thione (PubChem CID 9235343) has the molecular formula C17H24N5O2S2+ and a molecular weight of 394.55 g/mol. Its IUPAC name is 2-[[4-(benzenesulfonyl)piperazin-1-ium-1-yl]methyl]-5-methyl-4-prop-2-enyl-1,2,4-triazole-3-thione.
| Compound Name | 2-[[4-(benzenesulfonyl)piperazin-1-ium-1-yl]methyl]-5-methyl-4-prop-2-enyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 9235343 |
| Molecular Formula | C17H24N5O2S2+ |
| Molecular Weight | 394.55 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | 2-[[4-(benzenesulfonyl)piperazin-1-ium-1-yl]methyl]-5-methyl-4-prop-2-enyl-1,2,4-triazole-3-thione |
| SMILES | C=CCn1c(C)nn(C[NH+]2CCN(S(=O)(=O)c3ccccc3)CC2)c1=S |
| InChI | InChI=1S/C17H23N5O2S2/c1-3-9-21-15(2)18-22(17(21)25)14-19-10-12-20(13-11-19)26(23,24)16-7-5-4-6-8-16/h3-8H,1,9-14H2,2H3/p+1 |
| InChIKey | OLILXXRSVTWUPZ-UHFFFAOYSA-O |
| XLogP | 0.46 |
| TPSA | 64.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.55 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|