C19H25N5O2S2 — CID 27367901
5-methyl-2-[[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]methyl]-4-prop-2-enyl-1,2,4-triazole-3-thione (PubChem CID 27367901) has the molecular formula C19H25N5O2S2 and a molecular weight of 419.58 g/mol. Its IUPAC name is 5-methyl-2-[[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]methyl]-4-prop-2-enyl-1,2,4-triazole-3-thione.
| Compound Name | 5-methyl-2-[[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]methyl]-4-prop-2-enyl-1,2,4-triazole-3-thione |
|---|---|
| PubChem CID | 27367901 |
| Molecular Formula | C19H25N5O2S2 |
| Molecular Weight | 419.58 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | 5-methyl-2-[[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]methyl]-4-prop-2-enyl-1,2,4-triazole-3-thione |
| SMILES | C=CCn1c(C)nn(CN2CCN(S(=O)(=O)/C=C/c3ccccc3)CC2)c1=S |
| InChI | InChI=1S/C19H25N5O2S2/c1-3-10-23-17(2)20-24(19(23)27)16-21-11-13-22(14-12-21)28(25,26)15-9-18-7-5-4-6-8-18/h3-9,15H,1,10-14,16H2,2H3/b15-9+ |
| InChIKey | KMIUAARKGNUEMF-OQLLNIDSSA-N |
| XLogP | 2.48 |
| TPSA | 63.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.58 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|