C23H26N4O3S2 — CID 17477615
1-(4-methoxyphenyl)-3-[[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]methyl]imidazole-2-thione (PubChem CID 17477615) has the molecular formula C23H26N4O3S2 and a molecular weight of 470.62 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-[[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]methyl]imidazole-2-thione.
| Compound Name | 1-(4-methoxyphenyl)-3-[[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]methyl]imidazole-2-thione |
|---|---|
| PubChem CID | 17477615 |
| Molecular Formula | C23H26N4O3S2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-[[4-[(E)-2-phenylethenyl]sulfonylpiperazin-1-yl]methyl]imidazole-2-thione |
| SMILES | COc1ccc(-n2ccn(CN3CCN(S(=O)(=O)/C=C/c4ccccc4)CC3)c2=S)cc1 |
| InChI | InChI=1S/C23H26N4O3S2/c1-30-22-9-7-21(8-10-22)27-17-14-25(23(27)31)19-24-12-15-26(16-13-24)32(28,29)18-11-20-5-3-2-4-6-20/h2-11,14,17-18H,12-13,15-16,19H2,1H3/b18-11+ |
| InChIKey | VLYKMBZSGBQFKS-WOJGMQOQSA-N |
| XLogP | 3.59 |
| TPSA | 59.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|