C22H25N3O3S — CID 9243777
1-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-3-(4-methoxyphenyl)imidazole-2-thione (PubChem CID 9243777) has the molecular formula C22H25N3O3S and a molecular weight of 411.53 g/mol. Its IUPAC name is 1-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-3-(4-methoxyphenyl)imidazole-2-thione.
| Compound Name | 1-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-3-(4-methoxyphenyl)imidazole-2-thione |
|---|---|
| PubChem CID | 9243777 |
| Molecular Formula | C22H25N3O3S |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | 1-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-3-(4-methoxyphenyl)imidazole-2-thione |
| SMILES | COc1ccc(-n2ccn(CN3CCc4cc(OC)c(OC)cc4C3)c2=S)cc1 |
| InChI | InChI=1S/C22H25N3O3S/c1-26-19-6-4-18(5-7-19)25-11-10-24(22(25)29)15-23-9-8-16-12-20(27-2)21(28-3)13-17(16)14-23/h4-7,10-13H,8-9,14-15H2,1-3H3 |
| InChIKey | CVKIMTQDDOSXOX-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 40.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|