C22H31N3O2S — CID 9236539
1-cyclopentyl-3-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-4,5-dimethylimidazole-2-thione (PubChem CID 9236539) has the molecular formula C22H31N3O2S and a molecular weight of 401.58 g/mol. Its IUPAC name is 1-cyclopentyl-3-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-4,5-dimethylimidazole-2-thione.
| Compound Name | 1-cyclopentyl-3-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-4,5-dimethylimidazole-2-thione |
|---|---|
| PubChem CID | 9236539 |
| Molecular Formula | C22H31N3O2S |
| Molecular Weight | 401.58 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | 1-cyclopentyl-3-[(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl]-4,5-dimethylimidazole-2-thione |
| SMILES | COc1cc2c(cc1OC)CN(Cn1c(C)c(C)n(C3CCCC3)c1=S)CC2 |
| InChI | InChI=1S/C22H31N3O2S/c1-15-16(2)25(19-7-5-6-8-19)22(28)24(15)14-23-10-9-17-11-20(26-3)21(27-4)12-18(17)13-23/h11-12,19H,5-10,13-14H2,1-4H3 |
| InChIKey | RUKYYSUVTOHLMI-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 31.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.58 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|