C15H25NO2Si — CID 10085031
(6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl-trimethylsilane (PubChem CID 10085031) has the molecular formula C15H25NO2Si and a molecular weight of 279.46 g/mol. Its IUPAC name is (6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl-trimethylsilane.
| Compound Name | (6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl-trimethylsilane |
|---|---|
| PubChem CID | 10085031 |
| Molecular Formula | C15H25NO2Si |
| Molecular Weight | 279.46 g/mol |
| Exact Mass | 279.17 |
| IUPAC Name | (6,7-dimethoxy-3,4-dihydro-1H-isoquinolin-2-yl)methyl-trimethylsilane |
| SMILES | COc1cc2c(cc1OC)CN(C[Si](C)(C)C)CC2 |
| InChI | InChI=1S/C15H25NO2Si/c1-17-14-8-12-6-7-16(11-19(3,4)5)10-13(12)9-15(14)18-2/h8-9H,6-7,10-11H2,1-5H3 |
| InChIKey | ULAYJDKYWCMVLS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.46 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|