C16H23NO2 — CID 783060
6,7-dimethoxy-2-[(E)-2-methylbut-2-enyl]-3,4-dihydro-1H-isoquinoline (PubChem CID 783060) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is 6,7-dimethoxy-2-[(E)-2-methylbut-2-enyl]-3,4-dihydro-1H-isoquinoline.
| Compound Name | 6,7-dimethoxy-2-[(E)-2-methylbut-2-enyl]-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 783060 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 6,7-dimethoxy-2-[(E)-2-methylbut-2-enyl]-3,4-dihydro-1H-isoquinoline |
| SMILES | C/C=C(\C)CN1CCc2cc(OC)c(OC)cc2C1 |
| InChI | InChI=1S/C16H23NO2/c1-5-12(2)10-17-7-6-13-8-15(18-3)16(19-4)9-14(13)11-17/h5,8-9H,6-7,10-11H2,1-4H3/b12-5+ |
| InChIKey | AZDYIFVRAZPHHA-LFYBBSHMSA-N |
| XLogP | 3.03 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|