C22H26N4O3S2 — CID 46809611
1-(4-methoxyphenyl)-3-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]imidazole-2-thione (PubChem CID 46809611) has the molecular formula C22H26N4O3S2 and a molecular weight of 458.61 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-3-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]imidazole-2-thione.
| Compound Name | 1-(4-methoxyphenyl)-3-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]imidazole-2-thione |
|---|---|
| PubChem CID | 46809611 |
| Molecular Formula | C22H26N4O3S2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 1-(4-methoxyphenyl)-3-[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]imidazole-2-thione |
| SMILES | COc1ccc(-n2ccn(CN3CCN(S(=O)(=O)c4ccc(C)cc4)CC3)c2=S)cc1 |
| InChI | InChI=1S/C22H26N4O3S2/c1-18-3-9-21(10-4-18)31(27,28)25-14-11-23(12-15-25)17-24-13-16-26(22(24)30)19-5-7-20(29-2)8-6-19/h3-10,13,16H,11-12,14-15,17H2,1-2H3 |
| InChIKey | CHDSIPXZMRBIKB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 59.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|