C27H38N6O4S3 — CID 3101518
1,3-bis[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]imidazolidine-2-thione (PubChem CID 3101518) has the molecular formula C27H38N6O4S3 and a molecular weight of 606.84 g/mol. Its IUPAC name is 1,3-bis[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]imidazolidine-2-thione.
| Compound Name | 1,3-bis[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]imidazolidine-2-thione |
|---|---|
| PubChem CID | 3101518 |
| Molecular Formula | C27H38N6O4S3 |
| Molecular Weight | 606.84 g/mol |
| Exact Mass | 606.21 |
| IUPAC Name | 1,3-bis[[4-(4-methylphenyl)sulfonylpiperazin-1-yl]methyl]imidazolidine-2-thione |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(CN3CCN(CN4CCN(S(=O)(=O)c5ccc(C)cc5)CC4)C3=S)CC2)cc1 |
| InChI | InChI=1S/C27H38N6O4S3/c1-23-3-7-25(8-4-23)39(34,35)32-17-11-28(12-18-32)21-30-15-16-31(27(30)38)22-29-13-19-33(20-14-29)40(36,37)26-9-5-24(2)6-10-26/h3-10H,11-22H2,1-2H3 |
| InChIKey | HQUUVYDFKMGRHN-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 87.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.84 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|