C16H23N3O3S2 — CID 18133839
3-[[4-(4-methylphenyl)sulfonyl-1,4-diazepan-1-yl]methyl]-1,3-oxazolidine-2-thione (PubChem CID 18133839) has the molecular formula C16H23N3O3S2 and a molecular weight of 369.51 g/mol. Its IUPAC name is 3-[[4-(4-methylphenyl)sulfonyl-1,4-diazepan-1-yl]methyl]-1,3-oxazolidine-2-thione.
| Compound Name | 3-[[4-(4-methylphenyl)sulfonyl-1,4-diazepan-1-yl]methyl]-1,3-oxazolidine-2-thione |
|---|---|
| PubChem CID | 18133839 |
| Molecular Formula | C16H23N3O3S2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.12 |
| IUPAC Name | 3-[[4-(4-methylphenyl)sulfonyl-1,4-diazepan-1-yl]methyl]-1,3-oxazolidine-2-thione |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCN(CN3CCOC3=S)CC2)cc1 |
| InChI | InChI=1S/C16H23N3O3S2/c1-14-3-5-15(6-4-14)24(20,21)19-8-2-7-17(9-10-19)13-18-11-12-22-16(18)23/h3-6H,2,7-13H2,1H3 |
| InChIKey | PNMCMULLONKQTK-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|