C17H22N2O3S — CID 3743915
1-(furan-2-ylmethyl)-4-(4-methylphenyl)sulfonyl-1,4-diazepane (PubChem CID 3743915) has the molecular formula C17H22N2O3S and a molecular weight of 334.44 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-4-(4-methylphenyl)sulfonyl-1,4-diazepane.
| Compound Name | 1-(furan-2-ylmethyl)-4-(4-methylphenyl)sulfonyl-1,4-diazepane |
|---|---|
| PubChem CID | 3743915 |
| Molecular Formula | C17H22N2O3S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 1-(furan-2-ylmethyl)-4-(4-methylphenyl)sulfonyl-1,4-diazepane |
| SMILES | Cc1ccc(S(=O)(=O)N2CCCN(Cc3ccco3)CC2)cc1 |
| InChI | InChI=1S/C17H22N2O3S/c1-15-5-7-17(8-6-15)23(20,21)19-10-3-9-18(11-12-19)14-16-4-2-13-22-16/h2,4-8,13H,3,9-12,14H2,1H3 |
| InChIKey | YISIYSVAPRUIND-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |