C15H17BrN2O3S — CID 6466955
1-(4-bromophenyl)sulfonyl-4-(furan-2-ylmethyl)piperazine (PubChem CID 6466955) has the molecular formula C15H17BrN2O3S and a molecular weight of 385.28 g/mol. Its IUPAC name is 1-(4-bromophenyl)sulfonyl-4-(furan-2-ylmethyl)piperazine.
| Compound Name | 1-(4-bromophenyl)sulfonyl-4-(furan-2-ylmethyl)piperazine |
|---|---|
| PubChem CID | 6466955 |
| Molecular Formula | C15H17BrN2O3S |
| Molecular Weight | 385.28 g/mol |
| Exact Mass | 384.01 |
| IUPAC Name | 1-(4-bromophenyl)sulfonyl-4-(furan-2-ylmethyl)piperazine |
| SMILES | O=S(=O)(c1ccc(Br)cc1)N1CCN(Cc2ccco2)CC1 |
| InChI | InChI=1S/C15H17BrN2O3S/c16-13-3-5-15(6-4-13)22(19,20)18-9-7-17(8-10-18)12-14-2-1-11-21-14/h1-6,11H,7-10,12H2 |
| InChIKey | PHWVFBMAYVHVPQ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.28 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |