C13H19BrN2O4S2 — CID 78787612
1-(4-bromophenyl)sulfonyl-4-(2-methylsulfonylethyl)piperazine (PubChem CID 78787612) has the molecular formula C13H19BrN2O4S2 and a molecular weight of 411.34 g/mol. Its IUPAC name is 1-(4-bromophenyl)sulfonyl-4-(2-methylsulfonylethyl)piperazine.
| Compound Name | 1-(4-bromophenyl)sulfonyl-4-(2-methylsulfonylethyl)piperazine |
|---|---|
| PubChem CID | 78787612 |
| Molecular Formula | C13H19BrN2O4S2 |
| Molecular Weight | 411.34 g/mol |
| Exact Mass | 410.00 |
| IUPAC Name | 1-(4-bromophenyl)sulfonyl-4-(2-methylsulfonylethyl)piperazine |
| SMILES | CS(=O)(=O)CCN1CCN(S(=O)(=O)c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C13H19BrN2O4S2/c1-21(17,18)11-10-15-6-8-16(9-7-15)22(19,20)13-4-2-12(14)3-5-13/h2-5H,6-11H2,1H3 |
| InChIKey | JVQOTVGEYPGKJU-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.34 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |