C15H24N2O4S2 — CID 95753287
1-(2,5-dimethylphenyl)sulfonyl-4-(2-methylsulfonylethyl)piperazine (PubChem CID 95753287) has the molecular formula C15H24N2O4S2 and a molecular weight of 360.50 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)sulfonyl-4-(2-methylsulfonylethyl)piperazine.
| Compound Name | 1-(2,5-dimethylphenyl)sulfonyl-4-(2-methylsulfonylethyl)piperazine |
|---|---|
| PubChem CID | 95753287 |
| Molecular Formula | C15H24N2O4S2 |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.12 |
| IUPAC Name | 1-(2,5-dimethylphenyl)sulfonyl-4-(2-methylsulfonylethyl)piperazine |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCN(CCS(C)(=O)=O)CC2)c1 |
| InChI | InChI=1S/C15H24N2O4S2/c1-13-4-5-14(2)15(12-13)23(20,21)17-8-6-16(7-9-17)10-11-22(3,18)19/h4-5,12H,6-11H2,1-3H3 |
| InChIKey | ZDPXUEJXPDIRJP-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |