C16H23N3O2S — CID 8694159
4-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]butanenitrile (PubChem CID 8694159) has the molecular formula C16H23N3O2S and a molecular weight of 321.45 g/mol. Its IUPAC name is 4-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]butanenitrile.
| Compound Name | 4-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]butanenitrile |
|---|---|
| PubChem CID | 8694159 |
| Molecular Formula | C16H23N3O2S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | 4-[4-(2,5-dimethylphenyl)sulfonylpiperazin-1-yl]butanenitrile |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCN(CCCC#N)CC2)c1 |
| InChI | InChI=1S/C16H23N3O2S/c1-14-5-6-15(2)16(13-14)22(20,21)19-11-9-18(10-12-19)8-4-3-7-17/h5-6,13H,3-4,8-12H2,1-2H3 |
| InChIKey | GPVUHTUBJZMJHH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|